cas: 271261-71-3 — see every product listed under this CAS number, including other names
Methyl 2,4-dihydroxy-5-nitrobenzoate 95% (CAS 271261-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A339925-100mg |
| cas | 271261-71-3 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 10g | 1004.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A339925 |
Methyl 2,4-dihydroxy-5-nitrobenzoate (CAS 271261-71-3) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: methyl 2,4-dihydroxy-5-nitrobenzoate. InChIKey: RTNOQYZDKMGQGE-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | methyl 2,4-dihydroxy-5-nitrobenzoate |
| InChIKey | RTNOQYZDKMGQGE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)