cas: 1214332-41-8 — see every product listed under this CAS number, including other names
Methyl 2,6-difluoro-3-hydroxybenzoate, 98% (CAS 1214332-41-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-5616-1g |
| cas | 1214332-41-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 50mg | 435.28 Pln | |
| Fluorochem | 100mg | 664.37 Pln | |
| Fluorochem | 250mg | 1002.79 Pln | |
| Fluorochem | 500mg | 1752.53 Pln | |
| Fluorochem | 1g | 2236.73 Pln | |
| Fluorochem | 5g | 6375.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 2,6-difluoro-3-hydroxybenzoate (CAS 1214332-41-8) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: methyl 2,6-difluoro-3-hydroxybenzoate. InChIKey: IJXKUYJHKDPVBN-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | methyl 2,6-difluoro-3-hydroxybenzoate |
| InChIKey | IJXKUYJHKDPVBN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)O)F |
Computed by PubChem (NCBI)