cas: 7146-63-6 — see every product listed under this CAS number, including other names
Methyl 2-(1,3-dioxoisoindolin-2-yl)-3-phenylpropanoate, 95%, 95% (CAS 7146-63-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1177TE-100mg |
| cas | 7146-63-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1250.00 Pln | |
| Chemat | 1g | 2915.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (CAS 7146-63-6) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: methyl 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate. InChIKey: MQIGGLHZWMOEMY-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | methyl 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| InChIKey | MQIGGLHZWMOEMY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=CC=C1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)