cas: 210530-71-5 — see every product listed under this CAS number, including other names
Methyl 2-(3,4-difluorophenyl)acetate 98% (CAS 210530-71-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A794947-1g |
| cas | 210530-71-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 25g | 1471.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A794947 |
Methyl 2-(3,4-difluorophenyl)acetate (CAS 210530-71-5) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: methyl 2-(3,4-difluorophenyl)acetate. InChIKey: WXOJCEHMQHERFQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | methyl 2-(3,4-difluorophenyl)acetate |
| InChIKey | WXOJCEHMQHERFQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)