Products 210530-70-4
CAS 210530-70-4 appears in our catalog under these names: Methyl 2–(3，5–difluorophenyl)acetate, Methyl 2-(3,5-difluorophenyl)acetate, 97%, 97%, Methyl 2-(3,5-difluorophenyl)acetate, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g, 100g.
Methyl 2-(3,5-difluorophenyl)acetate (CAS 210530-70-4) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: methyl 2-(3,5-difluorophenyl)acetate. InChIKey: YBJMEHGTPXJXHZ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | methyl 2-(3,5-difluorophenyl)acetate |
| InChIKey | YBJMEHGTPXJXHZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC(=C1)F)F |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-(3,5-difluorophenyl)acetate, (3,5-difluoro-phenyl)-acetic acid methyl ester, 3,5-Difluorobenzeneacetic acid methyl ester, Methyl 3,5-difluorophenylacetate, Benzeneacetic acid, 3,5-difluoro-, methyl ester, Methyl (3,5-difluorophenyl)acetate, Methyl 3,5-Difluorobenzeneacetate, methyl(3,5-difluorophenyl)acetate, YBJMEHGTPXJXHZ-UHFFFAOYSA-N, Methyl2-(3,5-difluorophenyl)acetate