Methyl 2-(hydroxy(2-nitrophenyl)methyl)acrylate, 95%
cas: 159763-36-7 — see every product listed under this CAS number, including other names
Methyl 2-(hydroxy(2-nitrophenyl)methyl)acrylate, 95% (CAS 159763-36-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1670188-25mg |
| cas | 159763-36-7 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 615.13 Pln | |
| Ambeed | 50mg | 993.38 Pln | |
| Ambeed | 100mg | 1627.50 Pln | |
| Ambeed | 250mg | 2862.38 Pln | |
| Ambeed | 1g | 7612.75 Pln | |
| BLDpharm | 25mg | 658.68 Pln | |
| BLDpharm | 50mg | 1064.09 Pln | |
| BLDpharm | 100mg | 1747.19 Pln | |
| BLDpharm | 250mg | 3080.05 Pln | |
| BLDpharm | 1g | 8200.47 Pln | |
| Chemat | 25mg | 573.20 Pln | |
| Chemat | 50mg | 928.40 Pln | |
| Chemat | 100mg | 1538.00 Pln | |
| Chemat | 250mg | 2718.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-[hydroxy-(2-nitrophenyl)methyl]prop-2-enoate (CAS 159763-36-7) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: methyl 2-[hydroxy-(2-nitrophenyl)methyl]prop-2-enoate. InChIKey: QYEGBSLVNHSHFX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | methyl 2-[hydroxy-(2-nitrophenyl)methyl]prop-2-enoate |
| InChIKey | QYEGBSLVNHSHFX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C)C(C1=CC=CC=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)