Products 159763-36-7
CAS 159763-36-7 is the registry number for Methyl 2-(hydroxy(2-nitrophenyl)methyl)acrylate, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Methyl 2-[hydroxy-(2-nitrophenyl)methyl]prop-2-enoate (CAS 159763-36-7) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: methyl 2-[hydroxy-(2-nitrophenyl)methyl]prop-2-enoate. InChIKey: QYEGBSLVNHSHFX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | methyl 2-[hydroxy-(2-nitrophenyl)methyl]prop-2-enoate |
| InChIKey | QYEGBSLVNHSHFX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C)C(C1=CC=CC=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)