cas: 1261588-35-5 — see every product listed under this CAS number, including other names
Methyl 2-Bromo-4-iodobenzoate, 97%, 97% (CAS 1261588-35-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K5ZV-1g |
| cas | 1261588-35-5 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 25g | 674.00 Pln | |
| Chemat | 100g | 2454.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-bromo-4-iodobenzoate (CAS 1261588-35-5) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: methyl 2-bromo-4-iodobenzoate. InChIKey: AGPATUQJKLIKMY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | methyl 2-bromo-4-iodobenzoate |
| InChIKey | AGPATUQJKLIKMY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)I)Br |
Computed by PubChem (NCBI)