cas: 95067-27-9 — see every product listed under this CAS number, including other names
Methyl 2-acetamido-3-nitrobenzoate, 95% (CAS 95067-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226311-100MG |
| cas | 95067-27-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 924.69 Pln | |
| Fluorochem | 250mg | 1637.98 Pln | |
| Fluorochem | 500mg | 2569.95 Pln | |
| Fluorochem | 1g | 3793.47 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-acetamido-3-nitrobenzoate (CAS 95067-27-9) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: methyl 2-acetamido-3-nitrobenzoate. InChIKey: PHFRWNCHBPVTJN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | methyl 2-acetamido-3-nitrobenzoate |
| InChIKey | PHFRWNCHBPVTJN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC=C1[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)