CAS 1451146-79-4 is the registry number for 4-[Hydroxy(4-nitrophenyl)methyl]-1,3-oxazolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-[hydroxy-(4-nitrophenyl)methyl]-1,3-oxazolidin-2-one (CAS 1451146-79-4) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: 4-[hydroxy-(4-nitrophenyl)methyl]-1,3-oxazolidin-2-one. InChIKey: CGFNTQLZINKEQB-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 4-[hydroxy-(4-nitrophenyl)methyl]-1,3-oxazolidin-2-one |
| InChIKey | CGFNTQLZINKEQB-UHFFFAOYSA-N |
| SMILES | C1C(NC(=O)O1)C(C2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)