Products 6607-96-1
CAS 6607-96-1 is the registry number for N-(4-Acetyl-5-hydroxy-2-nitrophenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(4-acetyl-5-hydroxy-2-nitrophenyl)acetamide (CAS 6607-96-1) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: N-(4-acetyl-5-hydroxy-2-nitrophenyl)acetamide. InChIKey: LWTSKMDGAXLZJJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | N-(4-acetyl-5-hydroxy-2-nitrophenyl)acetamide |
| InChIKey | LWTSKMDGAXLZJJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1O)NC(=O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)