CAS 1251924-56-7 appears in our catalog under these names: 1-(2,4-Dimethyl-3,5-dinitrophenyl)ethan-1-one, 95%, 1-(2,4-Dimethyl-3,5-dinitrophenyl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-(2,4-dimethyl-3,5-dinitrophenyl)ethanone (CAS 1251924-56-7) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: 1-(2,4-dimethyl-3,5-dinitrophenyl)ethanone. InChIKey: QBSQTWSZUGJUBI-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 1-(2,4-dimethyl-3,5-dinitrophenyl)ethanone |
| InChIKey | QBSQTWSZUGJUBI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1C(=O)C)[N+](=O)[O-])C)[N+](=O)[O-] |
Computed by PubChem (NCBI)