cas: 42718-19-4 — see every product listed under this CAS number, including other names
Methyl 2-amino-2-(4-chlorophenyl)acetate hydrochloride 95% (CAS 42718-19-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A515647-250mg |
| cas | 42718-19-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 403.75 Pln | |
| Ambeed | 25g | 1738.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A515647 |
Methyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride (CAS 42718-19-4) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: methyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride. InChIKey: SLFXIBKUZFTNJA-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | methyl 2-amino-2-(4-chlorophenyl)acetate;hydrochloride |
| InChIKey | SLFXIBKUZFTNJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)