Methyl 2-amino-2-(p-tolyl)acetate hydrochloride, 98%
cas: 134722-09-1 — see every product listed under this CAS number, including other names
Methyl 2-amino-2-(p-tolyl)acetate hydrochloride, 98% (CAS 134722-09-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A244213-100mg |
| cas | 134722-09-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 2984.75 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 841.95 Pln | |
| BLDpharm | 5g | 3213.34 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 779.60 Pln | |
| Chemat | 5g | 2934.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-amino-2-(4-methylphenyl)acetate;hydrochloride (CAS 134722-09-1) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 2-amino-2-(4-methylphenyl)acetate;hydrochloride. InChIKey: FPOOPAKVFDSBMQ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 2-amino-2-(4-methylphenyl)acetate;hydrochloride |
| InChIKey | FPOOPAKVFDSBMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
methyl amino(4-methylphenyl)acetate hydrochloride, methyl 2-amino-2-(4-methylphenyl)acetate hydrochloride, methyl 2-amino-2-(p-tolyl)acetate hydrochloride, methyl 2-amino-2-(4-methylphenyl)acetate;hydrochloride, FPOOPAKVFDSBMQ-UHFFFAOYSA-N, methyl2-amino-2-(p-tolyl)acetatehydrochloride, methyl 2-amino-2-(4-methylphenyl)acetate HCl
