CAS 1184559-12-3 appears in our catalog under these names: Methyl 2-amino-3,5-difluorobenzoate, 95%, Methyl 2-amino-3,5-difluorobenzoate, Methyl 2-Amino-3,5-Difluorobenzoate, 98%, 98%, METHYL 2-AMINO-3,5-DIFLUOROBENZOATE, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25g.
Methyl 2-amino-3,5-difluorobenzoate (CAS 1184559-12-3) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 2-amino-3,5-difluorobenzoate. InChIKey: UZQBFUJQVJXUCQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 2-amino-3,5-difluorobenzoate |
| InChIKey | UZQBFUJQVJXUCQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)