Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 95%, 95%
cas: 34260-70-3 — see every product listed under this CAS number, including other names
Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 95%, 95% (CAS 34260-70-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C0H3-1g |
| cas | 34260-70-3 |
| size | 1g |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 659.60 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 5g | 2752.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride (CAS 34260-70-3) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride. InChIKey: WULJQXTZWBDFSE-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | WULJQXTZWBDFSE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
D,L-m-Tyrosine Methyl Ester Hydrochloride, Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride, Methyl 2-amino-3-(3-hydroxyphenyl)propanoate HCl, D,L-m-Tyrosine Methyl Ester HCl, Methyl2-amino-3-(3-hydroxyphenyl)propanoatehydrochloride, Methyl 3-hydroxyphenylalaninate--hydrogen chloride (1/1)