cas: 34260-70-3 — see every product listed under this CAS number, including other names
Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 98% (CAS 34260-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546869-100MG |
| cas | 34260-70-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 789.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride (CAS 34260-70-3) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride. InChIKey: WULJQXTZWBDFSE-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | WULJQXTZWBDFSE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)