CAS 1261797-04-9 appears in our catalog under these names: Methyl 2-bromo-3-iodobenzoate, 95%, Methyl 2–Bromo–3–Iodobenzoate, Methyl 2-bromo-3-iodobenzoate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 250mg, 100mg.
Methyl 2-bromo-3-iodobenzoate (CAS 1261797-04-9) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: methyl 2-bromo-3-iodobenzoate. InChIKey: JPSAQWAATAFSOK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | methyl 2-bromo-3-iodobenzoate |
| InChIKey | JPSAQWAATAFSOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)I)Br |
Computed by PubChem (NCBI)