cas: 6307-82-0 — see every product listed under this CAS number, including other names
Methyl 2-chloro-5-nitrobenzoate 98% (CAS 6307-82-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A244169-1g |
| cas | 6307-82-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 592.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A244169 |
Methyl 2-chloro-5-nitrobenzoate (CAS 6307-82-0) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: methyl 2-chloro-5-nitrobenzoate. InChIKey: VCYWZLGOWNCJNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | methyl 2-chloro-5-nitrobenzoate |
| InChIKey | VCYWZLGOWNCJNJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)