cas: 85070-58-2 — see every product listed under this CAS number, including other names
Methyl 2-fluoro-4-formylbenzoate 97% (CAS 85070-58-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A259317-250mg |
| cas | 85070-58-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 548.38 Pln | |
| Ambeed | 25g | 2206.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A259317 |
Methyl 2-fluoro-4-formylbenzoate (CAS 85070-58-2) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: methyl 2-fluoro-4-formylbenzoate. InChIKey: CFMGPKZYEUOERS-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | methyl 2-fluoro-4-formylbenzoate |
| InChIKey | CFMGPKZYEUOERS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C=O)F |
Computed by PubChem (NCBI)