cas: 106429-57-6 — see every product listed under this CAS number, including other names
Methyl 2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate 95% (CAS 106429-57-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A266432-250mg |
| cas | 106429-57-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 10g | 487.19 Pln | |
| Ambeed | 25g | 1110.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A266432 |
Methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (CAS 106429-57-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate. InChIKey: KZBROPAHLBJQQC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| InChIKey | KZBROPAHLBJQQC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NC(=O)N2 |
Computed by PubChem (NCBI)