cas: 90924-46-2 — see every product listed under this CAS number, including other names
Methyl 2-oxoindoline-4-carboxylate, 97%, 97% (CAS 90924-46-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RP5-250mg |
| cas | 90924-46-2 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1158.80 Pln | |
| Chemat | 10g | 1979.60 Pln | |
| Chemat | 25g | 3899.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-oxo-1,3-dihydroindole-4-carboxylate (CAS 90924-46-2) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 2-oxo-1,3-dihydroindole-4-carboxylate. InChIKey: FBKDEECWCACPLH-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 2-oxo-1,3-dihydroindole-4-carboxylate |
| InChIKey | FBKDEECWCACPLH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CC(=O)NC2=CC=C1 |
Computed by PubChem (NCBI)