cas: 856165-88-3 — see every product listed under this CAS number, including other names
Methyl 3,5-dichloro-4-isopropoxybenzoate (CAS 856165-88-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631715-1G |
| cas | 856165-88-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2486.64 Pln | |
| Fluorochem | 5g | 7313.07 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3,5-dichloro-4-propan-2-yloxybenzoate (CAS 856165-88-3) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: methyl 3,5-dichloro-4-propan-2-yloxybenzoate. InChIKey: BZGWUEFCUVETLA-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | methyl 3,5-dichloro-4-propan-2-yloxybenzoate |
| InChIKey | BZGWUEFCUVETLA-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)