cas: 1123172-87-1 — see every product listed under this CAS number, including other names
Methyl 3,5-difluoro-4-nitrobenzoate 95% (CAS 1123172-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A364096-100mg |
| cas | 1123172-87-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 971.12 Pln | |
| Ambeed | 25g | 3396.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A364096 |
Methyl 3,5-difluoro-4-nitrobenzoate (CAS 1123172-87-1) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: methyl 3,5-difluoro-4-nitrobenzoate. InChIKey: XXLVODHRRUKGIV-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | methyl 3,5-difluoro-4-nitrobenzoate |
| InChIKey | XXLVODHRRUKGIV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)