cas: 1123172-87-1 — see every product listed under this CAS number, including other names
Methyl 3,5-difluoro-4-nitrobenzoate, 98%, 98% (CAS 1123172-87-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 500g, 1kg, 100mg, 250mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FR6E-5g |
| cas | 1123172-87-1 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 438.80 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 500g | 16368.00 Pln | |
| Chemat | 1kg | 23805.20 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 1994.00 Pln | |
| Chemat | 100g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3,5-difluoro-4-nitrobenzoate (CAS 1123172-87-1) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: methyl 3,5-difluoro-4-nitrobenzoate. InChIKey: XXLVODHRRUKGIV-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | methyl 3,5-difluoro-4-nitrobenzoate |
| InChIKey | XXLVODHRRUKGIV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)