cas: 1029720-23-7 — see every product listed under this CAS number, including other names
Methyl 3-(dibromomethyl)picolinate, 97% (CAS 1029720-23-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F383975-5G |
| cas | 1029720-23-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 669.57 Pln | |
| Fluorochem | 10g | 1080.89 Pln | |
| Fluorochem | 25g | 2101.36 Pln | |
| Fluorochem | 100g | 5511.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-(dibromomethyl)pyridine-2-carboxylate (CAS 1029720-23-7) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: methyl 3-(dibromomethyl)pyridine-2-carboxylate. InChIKey: YTGAZDAXWNQXSJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | methyl 3-(dibromomethyl)pyridine-2-carboxylate |
| InChIKey | YTGAZDAXWNQXSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=N1)C(Br)Br |
Computed by PubChem (NCBI)