Products 886732-29-2
CAS 886732-29-2 appears in our catalog under these names: Methyl 3-cyano-5-fluorobenzoate, 98%, Methyl 3–cyano–5–fluorobenzoate, Methyl 3-cyano-5-fluorobenzoate, 96%, 96%, Methyl 3-cyano-5-fluorobenzoate, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 2.5g.
Methyl 3-cyano-5-fluorobenzoate (CAS 886732-29-2) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: methyl 3-cyano-5-fluorobenzoate. InChIKey: YZDWAFGKJVAXAM-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | methyl 3-cyano-5-fluorobenzoate |
| InChIKey | YZDWAFGKJVAXAM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C#N)F |
Computed by PubChem (NCBI)