Methyl 3-amino-2,4-dimethylbenzoate 96%
cas: 24812-89-3 — see every product listed under this CAS number, including other names
Methyl 3-amino-2,4-dimethylbenzoate 96% (CAS 24812-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A209779-100mg |
| cas | 24812-89-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 1154.69 Pln | |
| Ambeed | 25g | 5359.94 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A209779 |
Methyl 3-amino-2,4-dimethylbenzoate (CAS 24812-89-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 3-amino-2,4-dimethylbenzoate. InChIKey: VXCDYRLZDFQUCJ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 3-amino-2,4-dimethylbenzoate |
| InChIKey | VXCDYRLZDFQUCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)C)N |
Computed by PubChem (NCBI)
Synonyms:
Methyl 3-amino-2,4-dimethylbenzoate, methyl 3-amino-2,4-dimethyl-benzoate, Benzoic acid, 3-amino-2,4-dimethyl-, methyl ester, Benzoic acid, 3-?amino-?2,?4-?dimethyl-?, methyl ester, 3-Amino-2,4-dimethyl-benzoic acid methyl ester, Methyl3-amino-2,4-dimethylbenzoate, VXCDYRLZDFQUCJ-UHFFFAOYSA-N