CAS 249647-24-3 appears in our catalog under these names: Methyl 3–bromo–4–iodobenzoate, Methyl 3-bromo-4-iodobenzoate, 95%, Methyl 3-bromo-4-iodobenzoate, 98%, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 250mg.
Methyl 3-bromo-4-iodobenzoate (CAS 249647-24-3) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: methyl 3-bromo-4-iodobenzoate. InChIKey: OIMBMPVAESWCEA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | methyl 3-bromo-4-iodobenzoate |
| InChIKey | OIMBMPVAESWCEA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)I)Br |
Computed by PubChem (NCBI)