Methyl 3-fluorobenzene-1-sulfonate, 95%
cas: 1865148-58-8 — see every product listed under this CAS number, including other names
Methyl 3-fluorobenzene-1-sulfonate, 95% (CAS 1865148-58-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1126954-100mg |
| cas | 1865148-58-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Ambeed | 5g | 6222.12 Pln | |
| BLDpharm | 100mg | 514.29 Pln | |
| BLDpharm | 250mg | 819.74 Pln | |
| BLDpharm | 1g | 1730.53 Pln | |
| BLDpharm | 5g | 6706.55 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1192.40 Pln | |
| Chemat | 5g | 4576.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-fluorobenzenesulfonate (CAS 1865148-58-8) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: methyl 3-fluorobenzenesulfonate. InChIKey: KLINELVCVRRAJI-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | methyl 3-fluorobenzenesulfonate |
| InChIKey | KLINELVCVRRAJI-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=CC(=C1)F |
Computed by PubChem (NCBI)