CAS 167626-26-8 appears in our catalog under these names: Methyl 3-hydrazinylbenzoate hydrochloride, 95%, Methyl 3-hydrazinylbenzoate hydrochloride, Methyl 3-hydrazinylbenzoate hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 0,5g, 100mg.
Methyl 3-hydrazinylbenzoate;hydrochloride (CAS 167626-26-8) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: methyl 3-hydrazinylbenzoate;hydrochloride. InChIKey: OBALLCFRLYMDPH-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | methyl 3-hydrazinylbenzoate;hydrochloride |
| InChIKey | OBALLCFRLYMDPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)NN.Cl |
Computed by PubChem (NCBI)