cas: 500366-84-7 — see every product listed under this CAS number, including other names
Methyl 4-(4-fluorophenyl)-3-oxobutanoate, 97% (CAS 500366-84-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F763311-500MG |
| cas | 500366-84-7 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 950.72 Pln | |
| Fluorochem | 5g | 4038.18 Pln | |
| Fluorochem | 1g | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-(4-fluorophenyl)-3-oxobutanoate (CAS 500366-84-7) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-3-oxobutanoate. InChIKey: OZELTQPRZKEBGN-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | methyl 4-(4-fluorophenyl)-3-oxobutanoate |
| InChIKey | OZELTQPRZKEBGN-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)CC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)