CAS 75380-94-8 appears in our catalog under these names: 2-Methyl-4-oxo-4-(3'-fluorophenyl)butyric acid, 95%, 4-(3-Fluorophenyl)-2-methyl-4-oxobutanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(3-fluorophenyl)-2-methyl-4-oxobutanoic acid (CAS 75380-94-8) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: 4-(3-fluorophenyl)-2-methyl-4-oxobutanoic acid. InChIKey: CHYRXHBVBVPCLF-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | 4-(3-fluorophenyl)-2-methyl-4-oxobutanoic acid |
| InChIKey | CHYRXHBVBVPCLF-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C1=CC(=CC=C1)F)C(=O)O |
Computed by PubChem (NCBI)