CAS 1999-00-4 appears in our catalog under these names: ETHYL (4-FLUOROBENZOYL)ACETATE, Ethyl 4-fluorobenzoylacetate, 95%, ethyl 3-(4-fluorophenyl)-3-oxopropanoate, 97%, Ethyl (4-Fluorobenzoyl)acetate, >98.0%(GC)(T), Ethyl 3-(4-fluorophenyl)-3-oxopropanoate 96%. Offered by: Sigma-Aldrich, Fluorochem, Combi-blocks, TCI, Ambeed. Available pack sizes: 5G, 1g, 10g, 25g, 100g, 500g, 5 g, 10 g.
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate (CAS 1999-00-4) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)-3-oxopropanoate. InChIKey: SJUXLKYJKQBZLM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | ethyl 3-(4-fluorophenyl)-3-oxopropanoate |
| InChIKey | SJUXLKYJKQBZLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)