CAS 949449-09-6 is the registry number for (E)-Ethyl 3-(5-fluoro-2-hydroxyphenyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl (E)-3-(5-fluoro-2-hydroxyphenyl)prop-2-enoate (CAS 949449-09-6) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: ethyl (E)-3-(5-fluoro-2-hydroxyphenyl)prop-2-enoate. InChIKey: WPJUITWUKANQHJ-ZZXKWVIFSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | ethyl (E)-3-(5-fluoro-2-hydroxyphenyl)prop-2-enoate |
| InChIKey | WPJUITWUKANQHJ-ZZXKWVIFSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=CC(=C1)F)O |
Computed by PubChem (NCBI)