CAS 349-22-4 appears in our catalog under these names: 4-(4-Fluoro-3-methylphenyl)-4-oxobutanoic acid, 95%, 4-(4-Fluoro-3-methylphenyl)-4-oxobutanoic acid, 98+%, 4-(4-Fluoro-3-methylphenyl)-4-oxobutanoic acid, 98%, 98%, 4-(4-Fluoro-3-methyl-phenyl)-4-oxo-butyric acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid (CAS 349-22-4) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: 4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid. InChIKey: RDWYSVCUOZOEBC-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | 4-(4-fluoro-3-methylphenyl)-4-oxobutanoic acid |
| InChIKey | RDWYSVCUOZOEBC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)CCC(=O)O)F |
Computed by PubChem (NCBI)