Products 1783404-23-8
CAS 1783404-23-8 is the registry number for 1-[(3-Fluorophenoxy)methyl]cyclopropane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(3-fluorophenoxy)methyl]cyclopropane-1-carboxylic acid (CAS 1783404-23-8) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: 1-[(3-fluorophenoxy)methyl]cyclopropane-1-carboxylic acid. InChIKey: BQSRGRHXRPPUCX-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | 1-[(3-fluorophenoxy)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | BQSRGRHXRPPUCX-UHFFFAOYSA-N |
| SMILES | C1CC1(COC2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)