Products 1824630-36-5

CAS 1824630-36-5 is the registry number for 7-Fluoro-8-methylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

7-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1824630-36-5) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: 7-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UCRUUDLUVUCOBY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11FO3
Molecular weight210.20 g/mol
IUPAC name7-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyUCRUUDLUVUCOBY-UHFFFAOYSA-N
SMILESCC1=C(C=CC2=C1OCC(C2)C(=O)O)F

Computed by PubChem (NCBI)