Products 2031260-42-9
CAS 2031260-42-9 appears in our catalog under these names: Methyl 4-(aminomethyl)pyridine-2-carboxylate dihydrochloride, Methyl 4-(aminomethyl)picolinate dihydrochloride, 98%, 98%, Methyl 4-(aminomethyl)picolinate hydrochloride, 97%, Methyl 4-(aminomethyl)pyridine-2-carboxylate dihydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
Methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride (CAS 2031260-42-9) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride. InChIKey: YRZWDEKJYNLZBH-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | methyl 4-(aminomethyl)pyridine-2-carboxylate;dihydrochloride |
| InChIKey | YRZWDEKJYNLZBH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC(=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)