CAS 1039356-77-8 appears in our catalog under these names: Methyl 2-amino-2-(pyridin-2-yl)acetate dihydrochloride, 95%, Methyl 2-amino-2-(pyridin-2-yl)acetate dihydrochloride, 98%, Methyl 2–Amino–2–(2–pyridyl)acetate Dihydrochloride, Methyl 2-amino-2-(pyridin-2-yl)acetate dihydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 2-amino-2-pyridin-2-ylacetate;dihydrochloride (CAS 1039356-77-8) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: methyl 2-amino-2-pyridin-2-ylacetate;dihydrochloride. InChIKey: YEDLXAKJINMFAC-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | methyl 2-amino-2-pyridin-2-ylacetate;dihydrochloride |
| InChIKey | YEDLXAKJINMFAC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)