CAS 1427475-14-6 appears in our catalog under these names: Methyl 2-amino-2-(4-pyridyl)acetate dihydrochloride, 95%, Methyl 2–amino–2–(pyridin–4–yl)acetate dihydrochloride, Methyl 2-Amino-2-(4-pyridyl)acetate dihydrochloride, >95%, >95%, METHYL 2-AMINO-2-(4-PYRIDYL)ACETATE 2HCL, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
Methyl 2-amino-2-pyridin-4-ylacetate;dihydrochloride (CAS 1427475-14-6) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: methyl 2-amino-2-pyridin-4-ylacetate;dihydrochloride. InChIKey: ZLQBNTCOCJOQIN-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | methyl 2-amino-2-pyridin-4-ylacetate;dihydrochloride |
| InChIKey | ZLQBNTCOCJOQIN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)