CAS 1456506-89-0 is the registry number for methyl 2-amino-2-(pyridin-3-yl)acetate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-amino-2-pyridin-3-ylacetate;dihydrochloride (CAS 1456506-89-0) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: methyl 2-amino-2-pyridin-3-ylacetate;dihydrochloride. InChIKey: QPLUJZFPPWUBBG-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | methyl 2-amino-2-pyridin-3-ylacetate;dihydrochloride |
| InChIKey | QPLUJZFPPWUBBG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CN=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)