Products 1456506-89-0

CAS 1456506-89-0 is the registry number for methyl 2-amino-2-(pyridin-3-yl)acetate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-2-pyridin-3-ylacetate;dihydrochloride (CAS 1456506-89-0) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: methyl 2-amino-2-pyridin-3-ylacetate;dihydrochloride. InChIKey: QPLUJZFPPWUBBG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12Cl2N2O2
Molecular weight239.10 g/mol
IUPAC namemethyl 2-amino-2-pyridin-3-ylacetate;dihydrochloride
InChIKeyQPLUJZFPPWUBBG-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CN=CC=C1)N.Cl.Cl

Computed by PubChem (NCBI)