CAS 93960-21-5 appears in our catalog under these names: (R)-2-Amino-3-(pyridin-3-yl)propanoic acid dihydrochloride, 95%, 3-(3-Pyridyl)-D-alanine Dihydrochloride, 3–(3–Pyridyl)–D–alanine dihydrochloride, 3-(3-Pyridyl)-D-alanine Dihydrochloride, >98.0%(T)(HPLC), (R)-2-AMINO-3-(PYRIDIN-3-YL)PROPANOIC ACID DIHYDROCHLORIDE, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, on request, 25g, 5g.
(2R)-2-amino-3-pyridin-3-ylpropanoic acid;dihydrochloride (CAS 93960-21-5) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: (2R)-2-amino-3-pyridin-3-ylpropanoic acid;dihydrochloride. InChIKey: XORPRVNSFLBKBG-XCUBXKJBSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | (2R)-2-amino-3-pyridin-3-ylpropanoic acid;dihydrochloride |
| InChIKey | XORPRVNSFLBKBG-XCUBXKJBSA-N |
| SMILES | C1=CC(=CN=C1)C[C@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)