CAS 98062-70-5 appears in our catalog under these names: 2-Amino-3-(pyridin-2-yl)propanoic acid dihydrochloride, 95%, 2-Amino-3-(pyridin-2-yl)propanoic acid dihydrochloride, 95+%, 2-Amino-3-(pyridin-2-yl)propanoic acid dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g.
2-amino-3-pyridin-2-ylpropanoic acid;dihydrochloride (CAS 98062-70-5) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: 2-amino-3-pyridin-2-ylpropanoic acid;dihydrochloride. InChIKey: HGOJCMDWQOEDJA-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 2-amino-3-pyridin-2-ylpropanoic acid;dihydrochloride |
| InChIKey | HGOJCMDWQOEDJA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)