CAS 69179-66-4 appears in our catalog under these names: (R)-2-Amino-2-(4-aminophenyl)acetic acid dihydrochloride, 95%, (R)–2–Amino–2–(4–aminophenyl)acetic acid dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2R)-2-amino-2-(4-aminophenyl)acetic acid;dihydrochloride (CAS 69179-66-4) is a chemical compound with the molecular formula C8H12Cl2N2O2 and a molecular weight of 239.10 g/mol. IUPAC name: (2R)-2-amino-2-(4-aminophenyl)acetic acid;dihydrochloride. InChIKey: BLWAMKFMQILIGN-XCUBXKJBSA-N.
| Molecular formula | C8H12Cl2N2O2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-aminophenyl)acetic acid;dihydrochloride |
| InChIKey | BLWAMKFMQILIGN-XCUBXKJBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)