cas: 1263283-69-7 — see every product listed under this CAS number, including other names
Methyl 4-(chloromethyl)-3,5-difluorobenzoate 98% (CAS 1263283-69-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A186511-100mg |
| cas | 1263283-69-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1154.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A186511 |
Methyl 4-(chloromethyl)-3,5-difluorobenzoate (CAS 1263283-69-7) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: methyl 4-(chloromethyl)-3,5-difluorobenzoate. InChIKey: RWNXTXQXCJVRLY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | methyl 4-(chloromethyl)-3,5-difluorobenzoate |
| InChIKey | RWNXTXQXCJVRLY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)CCl)F |
Computed by PubChem (NCBI)