cas: 62435-37-4 — see every product listed under this CAS number, including other names
Methyl 4-(octyloxy)benzoate, 98% (CAS 62435-37-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F726560-25G |
| cas | 62435-37-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 404.04 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-octoxybenzoate (CAS 62435-37-4) is a chemical compound with the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. IUPAC name: methyl 4-octoxybenzoate. InChIKey: JCVLYBQFVTYGKT-UHFFFAOYSA-N.
| Molecular formula | C16H24O3 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | methyl 4-octoxybenzoate |
| InChIKey | JCVLYBQFVTYGKT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)