CAS 1260795-42-3 appears in our catalog under these names: Methyl 4–bromo–2–formylbenzoate, methyl 4-bromo-2-formylbenzoate, Methyl 4-bromo-2-formylbenzoate, 98%, 98%, Methyl 4-bromo-2-formylbenzoate, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 10g, 25g, 50g, 250mg, 1g.
Methyl 4-bromo-2-formylbenzoate (CAS 1260795-42-3) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 4-bromo-2-formylbenzoate. InChIKey: XXGNIICNQUKYLR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 4-bromo-2-formylbenzoate |
| InChIKey | XXGNIICNQUKYLR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)C=O |
Computed by PubChem (NCBI)