Methyl 4-chloro-2-hydroxybenzoate, 95%
cas: 22717-55-1 — see every product listed under this CAS number, including other names
Methyl 4-chloro-2-hydroxybenzoate, 95% (CAS 22717-55-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11468L-1g |
| cas | 22717-55-1 |
| size | 1g |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 50g | 352.40 Pln | |
| Chemat | 100g | 582.80 Pln | |
| Chemat | 250g | 1245.20 Pln | |
| Chemat | 500g | 2251.20 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 148.92 Pln | |
| Fluorochem | 10g | 211.40 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 732.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-chloro-2-hydroxybenzoate (CAS 22717-55-1) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: methyl 4-chloro-2-hydroxybenzoate. InChIKey: QXDWMJQRXWLSDP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | methyl 4-chloro-2-hydroxybenzoate |
| InChIKey | QXDWMJQRXWLSDP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)O |
Computed by PubChem (NCBI)