cas: 1093865-65-6 — see every product listed under this CAS number, including other names
Methyl 4-fluoro-3-formylbenzoate, 97% (CAS 1093865-65-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209878-250MG |
| cas | 1093865-65-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 737.26 Pln | |
| Fluorochem | 10g | 1320.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-fluoro-3-formylbenzoate (CAS 1093865-65-6) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: methyl 4-fluoro-3-formylbenzoate. InChIKey: VJWHOSFTDOXSAS-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | methyl 4-fluoro-3-formylbenzoate |
| InChIKey | VJWHOSFTDOXSAS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)C=O |
Computed by PubChem (NCBI)